3,5-Dimethyl-1,2-benzenediamine
Catalog No: FT-0678388
CAS No: 3171-46-8
- Chemical Name: 3,5-Dimethyl-1,2-benzenediamine
- Molecular Formula: C8H12N2
- Molecular Weight: 136.19
- InChI Key: DMEPVFSJYHJGCD-UHFFFAOYSA-N
- InChI: InChI=1S/C8H12N2/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,9-10H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 136.194 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 3171-46-8 |
| Bolling_Point: | 272.1±35.0 °C at 760 mmHg |
| Product_Name: | 3,5-dimethylbenzene-1,2-diamine |
| Melting_Point: | N/A |
| Flash_Point: | 139.4±25.4 °C |
| MF: | C8H12N2 |
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| LogP: | 0.97 |
| Flash_Point: | 139.4±25.4 °C |
| Refractive_Index: | 1.619 |
| FW: | 136.194 |
| PSA: | 52.04000 |
| MF: | C8H12N2 |
| Bolling_Point: | 272.1±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 136.100052 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2921590090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)